About 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid
4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid (PubChem CID 139931059) has the molecular formula C19H15ClN2O5
and a molecular weight of 386.79 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid |
| PubChem CID | 139931059 |
| Molecular Formula | C19H15ClN2O5 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid |
| SMILES | COc1ccc(CNc2cc(C(=O)O)nc3cccc(C(=O)O)c23)cc1Cl |
| InChI | InChI=1S/C19H15ClN2O5/c1-27-16-6-5-10(7-12(16)20)9-21-14-8-15(19(25)26)22-13-4-2-3-11(17(13)14)18(23)24/h2-8H,9H2,1H3,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | AOFJLNQOWXOCKQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid?
The IUPAC name of 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid (CID 139931059) is 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid.
What is the SMILES notation for 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid?
The canonical SMILES for 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid is COc1ccc(CNc2cc(C(=O)O)nc3cccc(C(=O)O)c23)cc1Cl.
What is the InChIKey of 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid?
The InChIKey is AOFJLNQOWXOCKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN2O5/c1-27-16-6-5-10(7-12(16)20)9-21-14-8-15(19(25)26)22-13-4-2-3-11(17(13)14)18(23)24/h2-8H,9H2,1H3,(H,21,22)(H,23,24)(H,25,26).
What are the key properties of 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid?
4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid has a molecular weight of 386.79 g/mol, XLogP of 3.91, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-chloro-4-methoxyphenyl)methylamino]quinoline-2,5-dicarboxylic acid is sourced from PubChem (CID 139931059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).