C21H18ClN5O3 — CID 142044640
methyl (1Z)-N-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyanoquinoline-2-carbonyl]methanehydrazonate (PubChem CID 142044640) has the molecular formula C21H18ClN5O3 and a molecular weight of 423.86 g/mol. Its IUPAC name is methyl (1Z)-N-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyanoquinoline-2-carbonyl]methanehydrazonate.
| Compound Name | methyl (1Z)-N-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyanoquinoline-2-carbonyl]methanehydrazonate |
|---|---|
| PubChem CID | 142044640 |
| Molecular Formula | C21H18ClN5O3 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | methyl (1Z)-N-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-cyanoquinoline-2-carbonyl]methanehydrazonate |
| SMILES | CO/C=N\NC(=O)c1cc(NCc2ccc(OC)c(Cl)c2)c2cc(C#N)ccc2n1 |
| InChI | InChI=1S/C21H18ClN5O3/c1-29-12-25-27-21(28)19-9-18(15-7-13(10-23)3-5-17(15)26-19)24-11-14-4-6-20(30-2)16(22)8-14/h3-9,12H,11H2,1-2H3,(H,24,26)(H,27,28)/b25-12- |
| InChIKey | HAHJVEIWDOKZSL-ROTLSHHCSA-N |
| XLogP | 3.70 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|