C16H16Cl2N2O3 — CID 22025937
ethyl 6-chloro-2-[(3-chloro-4-methoxyphenyl)methylamino]pyridine-3-carboxylate (PubChem CID 22025937) has the molecular formula C16H16Cl2N2O3 and a molecular weight of 355.22 g/mol. Its IUPAC name is ethyl 6-chloro-2-[(3-chloro-4-methoxyphenyl)methylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-2-[(3-chloro-4-methoxyphenyl)methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 22025937 |
| Molecular Formula | C16H16Cl2N2O3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | ethyl 6-chloro-2-[(3-chloro-4-methoxyphenyl)methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Cl)nc1NCc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2O3/c1-3-23-16(21)11-5-7-14(18)20-15(11)19-9-10-4-6-13(22-2)12(17)8-10/h4-8H,3,9H2,1-2H3,(H,19,20) |
| InChIKey | CCGIUBLVXIBMLX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|