C14H12Cl2N2O3 — CID 103292726
6-chloro-2-[(2-chloro-6-methoxyphenyl)methylamino]pyridine-3-carboxylic acid (PubChem CID 103292726) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is 6-chloro-2-[(2-chloro-6-methoxyphenyl)methylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-[(2-chloro-6-methoxyphenyl)methylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 103292726 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 6-chloro-2-[(2-chloro-6-methoxyphenyl)methylamino]pyridine-3-carboxylic acid |
| SMILES | COc1cccc(Cl)c1CNc1nc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C14H12Cl2N2O3/c1-21-11-4-2-3-10(15)9(11)7-17-13-8(14(19)20)5-6-12(16)18-13/h2-6H,7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | CMXDICSBMJBXCG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|