C25H23Cl2N3O2 — CID 11999308
6,8-bis(2-chlorophenyl)-7-(methoxymethoxy)-N-propan-2-ylquinazolin-2-amine (PubChem CID 11999308) has the molecular formula C25H23Cl2N3O2 and a molecular weight of 468.38 g/mol. Its IUPAC name is 6,8-bis(2-chlorophenyl)-7-(methoxymethoxy)-N-propan-2-ylquinazolin-2-amine.
| Compound Name | 6,8-bis(2-chlorophenyl)-7-(methoxymethoxy)-N-propan-2-ylquinazolin-2-amine |
|---|---|
| PubChem CID | 11999308 |
| Molecular Formula | C25H23Cl2N3O2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 6,8-bis(2-chlorophenyl)-7-(methoxymethoxy)-N-propan-2-ylquinazolin-2-amine |
| SMILES | COCOc1c(-c2ccccc2Cl)cc2cnc(NC(C)C)nc2c1-c1ccccc1Cl |
| InChI | InChI=1S/C25H23Cl2N3O2/c1-15(2)29-25-28-13-16-12-19(17-8-4-6-10-20(17)26)24(32-14-31-3)22(23(16)30-25)18-9-5-7-11-21(18)27/h4-13,15H,14H2,1-3H3,(H,28,29,30) |
| InChIKey | YVMWTORIVKVUJA-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|