C18H15ClF3N3O3S — CID 87254048
[6-(2-chlorophenyl)-2-(propan-2-ylamino)quinazolin-7-yl] trifluoromethanesulfonate (PubChem CID 87254048) has the molecular formula C18H15ClF3N3O3S and a molecular weight of 445.85 g/mol. Its IUPAC name is [6-(2-chlorophenyl)-2-(propan-2-ylamino)quinazolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [6-(2-chlorophenyl)-2-(propan-2-ylamino)quinazolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87254048 |
| Molecular Formula | C18H15ClF3N3O3S |
| Molecular Weight | 445.85 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | [6-(2-chlorophenyl)-2-(propan-2-ylamino)quinazolin-7-yl] trifluoromethanesulfonate |
| SMILES | CC(C)Nc1ncc2cc(-c3ccccc3Cl)c(OS(=O)(=O)C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C18H15ClF3N3O3S/c1-10(2)24-17-23-9-11-7-13(12-5-3-4-6-14(12)19)16(8-15(11)25-17)28-29(26,27)18(20,21)22/h3-10H,1-2H3,(H,23,24,25) |
| InChIKey | QEBTYXMGWRQUNE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.85 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|