About 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine
4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine (PubChem CID 162033873) has the molecular formula C10H8Cl4N4O2S2
and a molecular weight of 422.15 g/mol. Its IUPAC name is 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine.
Molecular Properties
| Compound Name | 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine |
| PubChem CID | 162033873 |
| Molecular Formula | C10H8Cl4N4O2S2 |
| Molecular Weight | 422.15 g/mol |
| Exact Mass | 419.88 |
| IUPAC Name | 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine |
| SMILES | CS(=O)(=O)c1nc(Cl)cc(Cl)n1.CSc1nc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C5H4Cl2N2O2S.C5H4Cl2N2S/c1-12(10,11)5-8-3(6)2-4(7)9-5;1-10-5-8-3(6)2-4(7)9-5/h2H,1H3;2H,1H3 |
| InChIKey | YWJSIVDRRNUGGF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.15 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine?
The IUPAC name of 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine (CID 162033873) is 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine.
What is the SMILES notation for 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine?
The canonical SMILES for 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine is CS(=O)(=O)c1nc(Cl)cc(Cl)n1.CSc1nc(Cl)cc(Cl)n1.
What is the InChIKey of 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine?
The InChIKey is YWJSIVDRRNUGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl2N2O2S.C5H4Cl2N2S/c1-12(10,11)5-8-3(6)2-4(7)9-5;1-10-5-8-3(6)2-4(7)9-5/h2H,1H3;2H,1H3.
What are the key properties of 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine?
4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine has a molecular weight of 422.15 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-2-methylsulfanylpyrimidine;4,6-dichloro-2-methylsulfonylpyrimidine is sourced from PubChem (CID 162033873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).