C6H5Cl2NO2S — CID 146177504
2,6-dichloro-4-methylsulfonylpyridine (PubChem CID 146177504) has the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. Its IUPAC name is 2,6-dichloro-4-methylsulfonylpyridine.
| Compound Name | 2,6-dichloro-4-methylsulfonylpyridine |
|---|---|
| PubChem CID | 146177504 |
| Molecular Formula | C6H5Cl2NO2S |
| Molecular Weight | 226.08 g/mol |
| Exact Mass | 224.94 |
| IUPAC Name | 2,6-dichloro-4-methylsulfonylpyridine |
| SMILES | CS(=O)(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C6H5Cl2NO2S/c1-12(10,11)4-2-5(7)9-6(8)3-4/h2-3H,1H3 |
| InChIKey | BEJONSVGNXODOK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.08 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|