C8H7BrCl2O2S — CID 53403733
2-(bromomethyl)-1,3-dichloro-5-methylsulfonylbenzene (PubChem CID 53403733) has the molecular formula C8H7BrCl2O2S and a molecular weight of 318.02 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-dichloro-5-methylsulfonylbenzene.
| Compound Name | 2-(bromomethyl)-1,3-dichloro-5-methylsulfonylbenzene |
|---|---|
| PubChem CID | 53403733 |
| Molecular Formula | C8H7BrCl2O2S |
| Molecular Weight | 318.02 g/mol |
| Exact Mass | 315.87 |
| IUPAC Name | 2-(bromomethyl)-1,3-dichloro-5-methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1cc(Cl)c(CBr)c(Cl)c1 |
| InChI | InChI=1S/C8H7BrCl2O2S/c1-14(12,13)5-2-7(10)6(4-9)8(11)3-5/h2-3H,4H2,1H3 |
| InChIKey | WRQHUFFFTMGIFV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.02 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|