C7H5BrCl2O2S — CID 53416560
2-bromo-1,3-dichloro-5-methylsulfonylbenzene (PubChem CID 53416560) has the molecular formula C7H5BrCl2O2S and a molecular weight of 303.99 g/mol. Its IUPAC name is 2-bromo-1,3-dichloro-5-methylsulfonylbenzene.
| Compound Name | 2-bromo-1,3-dichloro-5-methylsulfonylbenzene |
|---|---|
| PubChem CID | 53416560 |
| Molecular Formula | C7H5BrCl2O2S |
| Molecular Weight | 303.99 g/mol |
| Exact Mass | 301.86 |
| IUPAC Name | 2-bromo-1,3-dichloro-5-methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1cc(Cl)c(Br)c(Cl)c1 |
| InChI | InChI=1S/C7H5BrCl2O2S/c1-13(11,12)4-2-5(9)7(8)6(10)3-4/h2-3H,1H3 |
| InChIKey | HNBGVBYFILFHIJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.99 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|