C6H6Cl2N2O2S — CID 134119593
4,6-dichloro-3-methylsulfonylpyridin-2-amine (PubChem CID 134119593) has the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.10 g/mol. Its IUPAC name is 4,6-dichloro-3-methylsulfonylpyridin-2-amine.
| Compound Name | 4,6-dichloro-3-methylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 134119593 |
| Molecular Formula | C6H6Cl2N2O2S |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | 4,6-dichloro-3-methylsulfonylpyridin-2-amine |
| SMILES | CS(=O)(=O)c1c(Cl)cc(Cl)nc1N |
| InChI | InChI=1S/C6H6Cl2N2O2S/c1-13(11,12)5-3(7)2-4(8)10-6(5)9/h2H,1H3,(H2,9,10) |
| InChIKey | CEPOVZCRBMQELL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|