C8H8Cl2N2O2 — CID 175122080
3-(2-amino-4,6-dichloro-3-pyridinyl)propanoic acid (PubChem CID 175122080) has the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.07 g/mol. Its IUPAC name is 3-(2-amino-4,6-dichloro-3-pyridinyl)propanoic acid.
| Compound Name | 3-(2-amino-4,6-dichloro-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 175122080 |
| Molecular Formula | C8H8Cl2N2O2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 3-(2-amino-4,6-dichloro-3-pyridinyl)propanoic acid |
| SMILES | Nc1nc(Cl)cc(Cl)c1CCC(=O)O |
| InChI | InChI=1S/C8H8Cl2N2O2/c9-5-3-6(10)12-8(11)4(5)1-2-7(13)14/h3H,1-2H2,(H2,11,12)(H,13,14) |
| InChIKey | JHBPKNAHEQKGPQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|