C7H6BrCl2N — CID 169250788
3-bromo-2,4-dichloro-5,6-dimethylpyridine (PubChem CID 169250788) has the molecular formula C7H6BrCl2N and a molecular weight of 254.94 g/mol. Its IUPAC name is 3-bromo-2,4-dichloro-5,6-dimethylpyridine.
| Compound Name | 3-bromo-2,4-dichloro-5,6-dimethylpyridine |
|---|---|
| PubChem CID | 169250788 |
| Molecular Formula | C7H6BrCl2N |
| Molecular Weight | 254.94 g/mol |
| Exact Mass | 252.91 |
| IUPAC Name | 3-bromo-2,4-dichloro-5,6-dimethylpyridine |
| SMILES | Cc1nc(Cl)c(Br)c(Cl)c1C |
| InChI | InChI=1S/C7H6BrCl2N/c1-3-4(2)11-7(10)5(8)6(3)9/h1-2H3 |
| InChIKey | WSSWWXMCZYEXOT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.94 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|