C7H9IN2 — CID 10911871
5-Iodo-2,4,6-trimethylpyrimidine (PubChem CID 10911871) has the molecular formula C7H9IN2 and a molecular weight of 248.06 g/mol. Its IUPAC name is 5-iodo-2,4,6-trimethylpyrimidine.
| Compound Name | 5-Iodo-2,4,6-trimethylpyrimidine |
|---|---|
| PubChem CID | 10911871 |
| Molecular Formula | C7H9IN2 |
| Molecular Weight | 248.06 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 5-iodo-2,4,6-trimethylpyrimidine |
| SMILES | CC1=C(C(=NC(=N1)C)C)I |
| InChI | InChI=1S/C7H9IN2/c1-4-7(8)5(2)10-6(3)9-4/h1-3H3 |
| InChIKey | KAQRGRQQLJWGKW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 25.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | 106 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.06 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|