C8H8N2 — CID 13081754
2-ethynyl-4,6-dimethylpyrimidine (PubChem CID 13081754) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 2-ethynyl-4,6-dimethylpyrimidine.
| Compound Name | 2-ethynyl-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 13081754 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 2-ethynyl-4,6-dimethylpyrimidine |
| SMILES | C#Cc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C8H8N2/c1-4-8-9-6(2)5-7(3)10-8/h1,5H,2-3H3 |
| InChIKey | VGWRJXCDOHBOSC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|