C6H7ClN2 — CID 20550
2-chloro-4,6-dimethylpyrimidine (PubChem CID 20550) has the molecular formula C6H7ClN2 and a molecular weight of 142.59 g/mol. Its IUPAC name is 2-chloro-4,6-dimethylpyrimidine.
| Compound Name | 2-chloro-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 20550 |
| Molecular Formula | C6H7ClN2 |
| Molecular Weight | 142.59 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 2-chloro-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(Cl)n1 |
| InChI | InChI=1S/C6H7ClN2/c1-4-3-5(2)9-6(7)8-4/h3H,1-2H3 |
| InChIKey | RZVPFDOTMFYQHR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.59 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |