C11H6IN3 — CID 155283702
4-iodo-5,6-dimethylbenzene-1,2,3-tricarbonitrile (PubChem CID 155283702) has the molecular formula C11H6IN3 and a molecular weight of 307.09 g/mol. Its IUPAC name is 4-iodo-5,6-dimethylbenzene-1,2,3-tricarbonitrile.
| Compound Name | 4-iodo-5,6-dimethylbenzene-1,2,3-tricarbonitrile |
|---|---|
| PubChem CID | 155283702 |
| Molecular Formula | C11H6IN3 |
| Molecular Weight | 307.09 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 4-iodo-5,6-dimethylbenzene-1,2,3-tricarbonitrile |
| SMILES | Cc1c(C)c(C#N)c(C#N)c(C#N)c1I |
| InChI | InChI=1S/C11H6IN3/c1-6-7(2)11(12)10(5-15)9(4-14)8(6)3-13/h1-2H3 |
| InChIKey | ASNVGNCZBDVMSK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.09 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|