C22H16N2 — CID 139203251
1,6,7,10-tetramethylfluoranthene-8,9-dicarbonitrile (PubChem CID 139203251) has the molecular formula C22H16N2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1,6,7,10-tetramethylfluoranthene-8,9-dicarbonitrile.
| Compound Name | 1,6,7,10-tetramethylfluoranthene-8,9-dicarbonitrile |
|---|---|
| PubChem CID | 139203251 |
| Molecular Formula | C22H16N2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1,6,7,10-tetramethylfluoranthene-8,9-dicarbonitrile |
| SMILES | Cc1ccc2ccc(C)c3c2c1-c1c(C)c(C#N)c(C#N)c(C)c1-3 |
| InChI | InChI=1S/C22H16N2/c1-11-5-7-15-8-6-12(2)19-21-14(4)17(10-24)16(9-23)13(3)20(21)18(11)22(15)19/h5-8H,1-4H3 |
| InChIKey | CHNQFWVFHYJIEI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |