C32H24Br2 — CID 11813781
8,9-bis(2-bromophenyl)-1,6,7,10-tetramethylfluoranthene (PubChem CID 11813781) has the molecular formula C32H24Br2 and a molecular weight of 568.35 g/mol. Its IUPAC name is 8,9-bis(2-bromophenyl)-1,6,7,10-tetramethylfluoranthene.
| Compound Name | 8,9-bis(2-bromophenyl)-1,6,7,10-tetramethylfluoranthene |
|---|---|
| PubChem CID | 11813781 |
| Molecular Formula | C32H24Br2 |
| Molecular Weight | 568.35 g/mol |
| Exact Mass | 566.02 |
| IUPAC Name | 8,9-bis(2-bromophenyl)-1,6,7,10-tetramethylfluoranthene |
| SMILES | Cc1ccc2ccc(C)c3c2c1-c1c(C)c(-c2ccccc2Br)c(-c2ccccc2Br)c(C)c1-3 |
| InChI | InChI=1S/C32H24Br2/c1-17-13-15-21-16-14-18(2)27-31-20(4)29(23-10-6-8-12-25(23)34)28(22-9-5-7-11-24(22)33)19(3)30(31)26(17)32(21)27/h5-16H,1-4H3 |
| InChIKey | KHJADBNIGMWHJB-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.35 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |