C17H16BrN3 — CID 62829643
4-(2-bromophenyl)-5-(2,4-dimethylphenyl)-1H-pyrazol-3-amine (PubChem CID 62829643) has the molecular formula C17H16BrN3 and a molecular weight of 342.24 g/mol. Its IUPAC name is 4-(2-bromophenyl)-5-(2,4-dimethylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 4-(2-bromophenyl)-5-(2,4-dimethylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 62829643 |
| Molecular Formula | C17H16BrN3 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-(2-bromophenyl)-5-(2,4-dimethylphenyl)-1H-pyrazol-3-amine |
| SMILES | Cc1ccc(-c2[nH]nc(N)c2-c2ccccc2Br)c(C)c1 |
| InChI | InChI=1S/C17H16BrN3/c1-10-7-8-12(11(2)9-10)16-15(17(19)21-20-16)13-5-3-4-6-14(13)18/h3-9H,1-2H3,(H3,19,20,21) |
| InChIKey | RQPXBLJAMBWLBS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |