C16H13Br2N3 — CID 107955079
5-(2,4-dibromophenyl)-4-(2-methylphenyl)-1H-pyrazol-3-amine (PubChem CID 107955079) has the molecular formula C16H13Br2N3 and a molecular weight of 407.11 g/mol. Its IUPAC name is 5-(2,4-dibromophenyl)-4-(2-methylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(2,4-dibromophenyl)-4-(2-methylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 107955079 |
| Molecular Formula | C16H13Br2N3 |
| Molecular Weight | 407.11 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 5-(2,4-dibromophenyl)-4-(2-methylphenyl)-1H-pyrazol-3-amine |
| SMILES | Cc1ccccc1-c1c(N)n[nH]c1-c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H13Br2N3/c1-9-4-2-3-5-11(9)14-15(20-21-16(14)19)12-7-6-10(17)8-13(12)18/h2-8H,1H3,(H3,19,20,21) |
| InChIKey | AQMDUJVJYHUQPK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.11 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |