C9H9NS — CID 171015885
2,3-dimethyl-6-sulfanylbenzonitrile (PubChem CID 171015885) has the molecular formula C9H9NS and a molecular weight of 163.24 g/mol. Its IUPAC name is 2,3-dimethyl-6-sulfanylbenzonitrile.
| Compound Name | 2,3-dimethyl-6-sulfanylbenzonitrile |
|---|---|
| PubChem CID | 171015885 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 2,3-dimethyl-6-sulfanylbenzonitrile |
| SMILES | Cc1ccc(S)c(C#N)c1C |
| InChI | InChI=1S/C9H9NS/c1-6-3-4-9(11)8(5-10)7(6)2/h3-4,11H,1-2H3 |
| InChIKey | XCBLQNWKHLPUAC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|