C18H12N4O2 — CID 169425543
3,6-dihydroxybenzene-1,2-dicarbonitrile;3,6-dimethylbenzene-1,2-dicarbonitrile (PubChem CID 169425543) has the molecular formula C18H12N4O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 3,6-dihydroxybenzene-1,2-dicarbonitrile;3,6-dimethylbenzene-1,2-dicarbonitrile.
| Compound Name | 3,6-dihydroxybenzene-1,2-dicarbonitrile;3,6-dimethylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 169425543 |
| Molecular Formula | C18H12N4O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3,6-dihydroxybenzene-1,2-dicarbonitrile;3,6-dimethylbenzene-1,2-dicarbonitrile |
| SMILES | Cc1ccc(C)c(C#N)c1C#N.N#Cc1c(O)ccc(O)c1C#N |
| InChI | InChI=1S/C10H8N2.C8H4N2O2/c1-7-3-4-8(2)10(6-12)9(7)5-11;9-3-5-6(4-10)8(12)2-1-7(5)11/h3-4H,1-2H3;1-2,11-12H |
| InChIKey | GVMIEIZFDZRZRD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|