C7H7N3O — CID 171010928
2,3-diamino-6-hydroxybenzonitrile (PubChem CID 171010928) has the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. Its IUPAC name is 2,3-diamino-6-hydroxybenzonitrile.
| Compound Name | 2,3-diamino-6-hydroxybenzonitrile |
|---|---|
| PubChem CID | 171010928 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 2,3-diamino-6-hydroxybenzonitrile |
| SMILES | N#Cc1c(O)ccc(N)c1N |
| InChI | InChI=1S/C7H7N3O/c8-3-4-6(11)2-1-5(9)7(4)10/h1-2,11H,9-10H2 |
| InChIKey | ADCWASKUFPWICP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|