C10H12N2O2 — CID 130061973
2-(1-aminopropyl)-3,6-dihydroxybenzonitrile (PubChem CID 130061973) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(1-aminopropyl)-3,6-dihydroxybenzonitrile.
| Compound Name | 2-(1-aminopropyl)-3,6-dihydroxybenzonitrile |
|---|---|
| PubChem CID | 130061973 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(1-aminopropyl)-3,6-dihydroxybenzonitrile |
| SMILES | CCC(N)c1c(O)ccc(O)c1C#N |
| InChI | InChI=1S/C10H12N2O2/c1-2-7(12)10-6(5-11)8(13)3-4-9(10)14/h3-4,7,13-14H,2,12H2,1H3 |
| InChIKey | DORWFQAZCSRNIN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|