C8H7NO2 — CID 130033586
3,6-dihydroxy-2-methylbenzonitrile (PubChem CID 130033586) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is 3,6-dihydroxy-2-methylbenzonitrile.
| Compound Name | 3,6-dihydroxy-2-methylbenzonitrile |
|---|---|
| PubChem CID | 130033586 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 3,6-dihydroxy-2-methylbenzonitrile |
| SMILES | Cc1c(O)ccc(O)c1C#N |
| InChI | InChI=1S/C8H7NO2/c1-5-6(4-9)8(11)3-2-7(5)10/h2-3,10-11H,1H3 |
| InChIKey | RLOVDIQSUFWRQW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|