C8H5N3O2 — CID 90015414
2-amino-4,5-dihydroxybenzene-1,3-dicarbonitrile (PubChem CID 90015414) has the molecular formula C8H5N3O2 and a molecular weight of 175.15 g/mol. Its IUPAC name is 2-amino-4,5-dihydroxybenzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4,5-dihydroxybenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90015414 |
| Molecular Formula | C8H5N3O2 |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 2-amino-4,5-dihydroxybenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(O)c(O)c(C#N)c1N |
| InChI | InChI=1S/C8H5N3O2/c9-2-4-1-6(12)8(13)5(3-10)7(4)11/h1,12-13H,11H2 |
| InChIKey | LPPKZFJPKJTNGQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|