C12H11N3O3 — CID 90015410
4,5-dihydroxy-2-morpholin-4-ylbenzene-1,3-dicarbonitrile (PubChem CID 90015410) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 4,5-dihydroxy-2-morpholin-4-ylbenzene-1,3-dicarbonitrile.
| Compound Name | 4,5-dihydroxy-2-morpholin-4-ylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90015410 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4,5-dihydroxy-2-morpholin-4-ylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(O)c(O)c(C#N)c1N1CCOCC1 |
| InChI | InChI=1S/C12H11N3O3/c13-6-8-5-10(16)12(17)9(7-14)11(8)15-1-3-18-4-2-15/h5,16-17H,1-4H2 |
| InChIKey | PTORHPQDQRZXNR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|