C19H15N3O4 — CID 90015873
4,5-dihydroxy-2-[3-(morpholine-4-carbonyl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 90015873) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 4,5-dihydroxy-2-[3-(morpholine-4-carbonyl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 4,5-dihydroxy-2-[3-(morpholine-4-carbonyl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90015873 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4,5-dihydroxy-2-[3-(morpholine-4-carbonyl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(O)c(O)c(C#N)c1-c1cccc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H15N3O4/c20-10-14-9-16(23)18(24)15(11-21)17(14)12-2-1-3-13(8-12)19(25)22-4-6-26-7-5-22/h1-3,8-9,23-24H,4-7H2 |
| InChIKey | YHRPANAPBMJPGG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|