C13H10N2O2 — CID 90016352
2-(cyclopenten-1-yl)-4,5-dihydroxybenzene-1,3-dicarbonitrile (PubChem CID 90016352) has the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-4,5-dihydroxybenzene-1,3-dicarbonitrile.
| Compound Name | 2-(cyclopenten-1-yl)-4,5-dihydroxybenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90016352 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-(cyclopenten-1-yl)-4,5-dihydroxybenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(O)c(O)c(C#N)c1C1=CCCC1 |
| InChI | InChI=1S/C13H10N2O2/c14-6-9-5-11(16)13(17)10(7-15)12(9)8-3-1-2-4-8/h3,5,16-17H,1-2,4H2 |
| InChIKey | JYGNUCVLCNSQGM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|