C11H8N2O2 — CID 90016422
4,5-dihydroxy-2-prop-2-enylbenzene-1,3-dicarbonitrile (PubChem CID 90016422) has the molecular formula C11H8N2O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is 4,5-dihydroxy-2-prop-2-enylbenzene-1,3-dicarbonitrile.
| Compound Name | 4,5-dihydroxy-2-prop-2-enylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90016422 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4,5-dihydroxy-2-prop-2-enylbenzene-1,3-dicarbonitrile |
| SMILES | C=CCc1c(C#N)cc(O)c(O)c1C#N |
| InChI | InChI=1S/C11H8N2O2/c1-2-3-8-7(5-12)4-10(14)11(15)9(8)6-13/h2,4,14-15H,1,3H2 |
| InChIKey | IOUCRKFWYNFTCU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|