C12H7N3 — CID 91802152
2-prop-2-enylbenzene-1,3,5-tricarbonitrile (PubChem CID 91802152) has the molecular formula C12H7N3 and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-prop-2-enylbenzene-1,3,5-tricarbonitrile.
| Compound Name | 2-prop-2-enylbenzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 91802152 |
| Molecular Formula | C12H7N3 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-prop-2-enylbenzene-1,3,5-tricarbonitrile |
| SMILES | C=CCc1c(C#N)cc(C#N)cc1C#N |
| InChI | InChI=1S/C12H7N3/c1-2-3-12-10(7-14)4-9(6-13)5-11(12)8-15/h2,4-5H,1,3H2 |
| InChIKey | QOTVGVFCSPLTFV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|