sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile

C9H3N3NaS+ — CID 22351751

IUPACsodium 2-sulfanylbenzene-1,3,5-tricarbonitrile
SMILESN#Cc1cc(C#N)c(S)c(C#N)c1.[Na+]
InChIInChI=1S/C9H3N3S.Na/c10-3-6-1-7(4-11)9(13)8(2-6)5-12;/h1-2,13H;/q;+1
InChIKeyFVVUNSAFBPRYKJ-UHFFFAOYSA-N
MW208.20 g/mol
LogP-1.41
Rot. Bonds

About sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile

sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile (PubChem CID 22351751) has the molecular formula C9H3N3NaS+ and a molecular weight of 208.20 g/mol. Its IUPAC name is sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile.

Molecular Properties

Compound Namesodium 2-sulfanylbenzene-1,3,5-tricarbonitrile
PubChem CID22351751
Molecular FormulaC9H3N3NaS+
Molecular Weight208.20 g/mol
Exact Mass207.99
IUPAC Namesodium 2-sulfanylbenzene-1,3,5-tricarbonitrile
SMILESN#Cc1cc(C#N)c(S)c(C#N)c1.[Na+]
InChIInChI=1S/C9H3N3S.Na/c10-3-6-1-7(4-11)9(13)8(2-6)5-12;/h1-2,13H;/q;+1
InChIKeyFVVUNSAFBPRYKJ-UHFFFAOYSA-N
XLogP-1.41
TPSA71.37 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.20
LogP ≤ 5-1.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile?
The IUPAC name of sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile (CID 22351751) is sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile.
What is the SMILES notation for sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile?
The canonical SMILES for sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile is N#Cc1cc(C#N)c(S)c(C#N)c1.[Na+].
What is the InChIKey of sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile?
The InChIKey is FVVUNSAFBPRYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3N3S.Na/c10-3-6-1-7(4-11)9(13)8(2-6)5-12;/h1-2,13H;/q;+1.
What are the key properties of sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile?
sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile has a molecular weight of 208.20 g/mol, XLogP of -1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile is sourced from PubChem (CID 22351751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).