C9H3N3NaS+ — CID 22351751
sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile (PubChem CID 22351751) has the molecular formula C9H3N3NaS+ and a molecular weight of 208.20 g/mol. Its IUPAC name is sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile.
| Compound Name | sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 22351751 |
| Molecular Formula | C9H3N3NaS+ |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | sodium 2-sulfanylbenzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1cc(C#N)c(S)c(C#N)c1.[Na+] |
| InChI | InChI=1S/C9H3N3S.Na/c10-3-6-1-7(4-11)9(13)8(2-6)5-12;/h1-2,13H;/q;+1 |
| InChIKey | FVVUNSAFBPRYKJ-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|