C7H3Cl2NS — CID 177238776
3,5-dichloro-4-sulfanylbenzonitrile (PubChem CID 177238776) has the molecular formula C7H3Cl2NS and a molecular weight of 204.08 g/mol. Its IUPAC name is 3,5-dichloro-4-sulfanylbenzonitrile.
| Compound Name | 3,5-dichloro-4-sulfanylbenzonitrile |
|---|---|
| PubChem CID | 177238776 |
| Molecular Formula | C7H3Cl2NS |
| Molecular Weight | 204.08 g/mol |
| Exact Mass | 202.94 |
| IUPAC Name | 3,5-dichloro-4-sulfanylbenzonitrile |
| SMILES | N#Cc1cc(Cl)c(S)c(Cl)c1 |
| InChI | InChI=1S/C7H3Cl2NS/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H |
| InChIKey | GXAPQUVGKIPNCE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.08 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|