About 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile
2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile (PubChem CID 23382496) has the molecular formula C9H3Cl3N2
and a molecular weight of 245.50 g/mol. Its IUPAC name is 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile |
| PubChem CID | 23382496 |
| Molecular Formula | C9H3Cl3N2 |
| Molecular Weight | 245.50 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile |
| SMILES | Cc1c(Cl)c(C#N)c(Cl)c(Cl)c1C#N |
| InChI | InChI=1S/C9H3Cl3N2/c1-4-5(2-13)8(11)9(12)6(3-14)7(4)10/h1H3 |
| InChIKey | CCDMRSTZCVXCPM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile?
The IUPAC name of 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile (CID 23382496) is 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile.
What is the SMILES notation for 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile?
The canonical SMILES for 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile is Cc1c(Cl)c(C#N)c(Cl)c(Cl)c1C#N.
What is the InChIKey of 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile?
The InChIKey is CCDMRSTZCVXCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3Cl3N2/c1-4-5(2-13)8(11)9(12)6(3-14)7(4)10/h1H3.
What are the key properties of 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile?
2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile has a molecular weight of 245.50 g/mol, XLogP of 3.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile is sourced from PubChem (CID 23382496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).