C9H3Cl3N2 — CID 23382496
2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile (PubChem CID 23382496) has the molecular formula C9H3Cl3N2 and a molecular weight of 245.50 g/mol. Its IUPAC name is 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile.
| Compound Name | 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 23382496 |
| Molecular Formula | C9H3Cl3N2 |
| Molecular Weight | 245.50 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | 2,3,5-trichloro-6-methylbenzene-1,4-dicarbonitrile |
| SMILES | Cc1c(Cl)c(C#N)c(Cl)c(Cl)c1C#N |
| InChI | InChI=1S/C9H3Cl3N2/c1-4-5(2-13)8(11)9(12)6(3-14)7(4)10/h1H3 |
| InChIKey | CCDMRSTZCVXCPM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|