C15H6Cl4FN3 — CID 89300272
2,4,5-trichloro-6-(2-chloro-6-fluoro-4-methylanilino)benzene-1,3-dicarbonitrile (PubChem CID 89300272) has the molecular formula C15H6Cl4FN3 and a molecular weight of 389.04 g/mol. Its IUPAC name is 2,4,5-trichloro-6-(2-chloro-6-fluoro-4-methylanilino)benzene-1,3-dicarbonitrile.
| Compound Name | 2,4,5-trichloro-6-(2-chloro-6-fluoro-4-methylanilino)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 89300272 |
| Molecular Formula | C15H6Cl4FN3 |
| Molecular Weight | 389.04 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | 2,4,5-trichloro-6-(2-chloro-6-fluoro-4-methylanilino)benzene-1,3-dicarbonitrile |
| SMILES | Cc1cc(F)c(Nc2c(Cl)c(Cl)c(C#N)c(Cl)c2C#N)c(Cl)c1 |
| InChI | InChI=1S/C15H6Cl4FN3/c1-6-2-9(16)15(10(20)3-6)23-14-8(5-22)11(17)7(4-21)12(18)13(14)19/h2-3,23H,1H3 |
| InChIKey | DLTRWVZVZNIPHZ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.04 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|