C9H9ClN2 — CID 117027810
(2-chloro-4,6-dimethylphenyl)cyanamide (PubChem CID 117027810) has the molecular formula C9H9ClN2 and a molecular weight of 180.64 g/mol. Its IUPAC name is (2-chloro-4,6-dimethylphenyl)cyanamide.
| Compound Name | (2-chloro-4,6-dimethylphenyl)cyanamide |
|---|---|
| PubChem CID | 117027810 |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (2-chloro-4,6-dimethylphenyl)cyanamide |
| SMILES | Cc1cc(C)c(NC#N)c(Cl)c1 |
| InChI | InChI=1S/C9H9ClN2/c1-6-3-7(2)9(12-5-11)8(10)4-6/h3-4,12H,1-2H3 |
| InChIKey | VJNQZQLBBUQQJK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|