C10H14ClNS — CID 145156004
2-chloro-4,6-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline (PubChem CID 145156004) has the molecular formula C10H14ClNS and a molecular weight of 215.75 g/mol. Its IUPAC name is 2-chloro-4,6-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline.
| Compound Name | 2-chloro-4,6-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline |
|---|---|
| PubChem CID | 145156004 |
| Molecular Formula | C10H14ClNS |
| Molecular Weight | 215.75 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-chloro-4,6-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline |
| SMILES | C=S(C)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C10H14ClNS/c1-7-5-8(2)10(9(11)6-7)12-13(3)4/h5-6,12H,3H2,1-2,4H3 |
| InChIKey | QQQQZMLGFGTBLZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.75 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|