About 1-chloro-2,3,5-trimethylbenzene;ethane
1-chloro-2,3,5-trimethylbenzene;ethane (PubChem CID 142028955) has the molecular formula C11H17Cl
and a molecular weight of 184.71 g/mol. Its IUPAC name is 1-chloro-2,3,5-trimethylbenzene;ethane.
Molecular Properties
| Compound Name | 1-chloro-2,3,5-trimethylbenzene;ethane |
| PubChem CID | 142028955 |
| Molecular Formula | C11H17Cl |
| Molecular Weight | 184.71 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-chloro-2,3,5-trimethylbenzene;ethane |
| SMILES | CC.Cc1cc(C)c(C)c(Cl)c1 |
| InChI | InChI=1S/C9H11Cl.C2H6/c1-6-4-7(2)8(3)9(10)5-6;1-2/h4-5H,1-3H3;1-2H3 |
| InChIKey | QEUKKVGSVYVZQL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2,3,5-trimethylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,3,5-trimethylbenzene;ethane?
The IUPAC name of 1-chloro-2,3,5-trimethylbenzene;ethane (CID 142028955) is 1-chloro-2,3,5-trimethylbenzene;ethane.
What is the SMILES notation for 1-chloro-2,3,5-trimethylbenzene;ethane?
The canonical SMILES for 1-chloro-2,3,5-trimethylbenzene;ethane is CC.Cc1cc(C)c(C)c(Cl)c1.
What is the InChIKey of 1-chloro-2,3,5-trimethylbenzene;ethane?
The InChIKey is QEUKKVGSVYVZQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl.C2H6/c1-6-4-7(2)8(3)9(10)5-6;1-2/h4-5H,1-3H3;1-2H3.
What are the key properties of 1-chloro-2,3,5-trimethylbenzene;ethane?
1-chloro-2,3,5-trimethylbenzene;ethane has a molecular weight of 184.71 g/mol, XLogP of 4.29, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,3,5-trimethylbenzene;ethane is sourced from PubChem (CID 142028955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).