C11H17Cl — CID 142028955
1-chloro-2,3,5-trimethylbenzene;ethane (PubChem CID 142028955) has the molecular formula C11H17Cl and a molecular weight of 184.71 g/mol. Its IUPAC name is 1-chloro-2,3,5-trimethylbenzene;ethane.
| Compound Name | 1-chloro-2,3,5-trimethylbenzene;ethane |
|---|---|
| PubChem CID | 142028955 |
| Molecular Formula | C11H17Cl |
| Molecular Weight | 184.71 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-chloro-2,3,5-trimethylbenzene;ethane |
| SMILES | CC.Cc1cc(C)c(C)c(Cl)c1 |
| InChI | InChI=1S/C9H11Cl.C2H6/c1-6-4-7(2)8(3)9(10)5-6;1-2/h4-5H,1-3H3;1-2H3 |
| InChIKey | QEUKKVGSVYVZQL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |