C9H10ClI — CID 170736542
1-chloro-2-(iodomethyl)-3,5-dimethylbenzene (PubChem CID 170736542) has the molecular formula C9H10ClI and a molecular weight of 280.54 g/mol. Its IUPAC name is 1-chloro-2-(iodomethyl)-3,5-dimethylbenzene.
| Compound Name | 1-chloro-2-(iodomethyl)-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 170736542 |
| Molecular Formula | C9H10ClI |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | 1-chloro-2-(iodomethyl)-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)c(CI)c(Cl)c1 |
| InChI | InChI=1S/C9H10ClI/c1-6-3-7(2)8(5-11)9(10)4-6/h3-4H,5H2,1-2H3 |
| InChIKey | OZLODLKGAOOHNN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|