C12H15Cl — CID 143995722
1-chloro-2-(cyclopropylmethyl)-3,5-dimethylbenzene (PubChem CID 143995722) has the molecular formula C12H15Cl and a molecular weight of 194.71 g/mol. Its IUPAC name is 1-chloro-2-(cyclopropylmethyl)-3,5-dimethylbenzene.
| Compound Name | 1-chloro-2-(cyclopropylmethyl)-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 143995722 |
| Molecular Formula | C12H15Cl |
| Molecular Weight | 194.71 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-chloro-2-(cyclopropylmethyl)-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)c(CC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl/c1-8-5-9(2)11(12(13)6-8)7-10-3-4-10/h5-6,10H,3-4,7H2,1-2H3 |
| InChIKey | QUHVPCQMXFLRBW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |