C15H22O2 — CID 123388666
2-[(4-hydroxycyclohexyl)methyl]-4,6-dimethylphenol (PubChem CID 123388666) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-[(4-hydroxycyclohexyl)methyl]-4,6-dimethylphenol.
| Compound Name | 2-[(4-hydroxycyclohexyl)methyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 123388666 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-[(4-hydroxycyclohexyl)methyl]-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(CC2CCC(O)CC2)c1 |
| InChI | InChI=1S/C15H22O2/c1-10-7-11(2)15(17)13(8-10)9-12-3-5-14(16)6-4-12/h7-8,12,14,16-17H,3-6,9H2,1-2H3 |
| InChIKey | VQCRYCKUYRXFFN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |