C15H22O — CID 15094976
2-(cyclohexylmethyl)-4,6-dimethylphenol (PubChem CID 15094976) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-4,6-dimethylphenol.
| Compound Name | 2-(cyclohexylmethyl)-4,6-dimethylphenol |
|---|---|
| PubChem CID | 15094976 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2-(cyclohexylmethyl)-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(CC2CCCCC2)c1 |
| InChI | InChI=1S/C15H22O/c1-11-8-12(2)15(16)14(9-11)10-13-6-4-3-5-7-13/h8-9,13,16H,3-7,10H2,1-2H3 |
| InChIKey | BIQFNHMXICGPSS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |