C22H34 — CID 59821631
1,4-bis(cyclohexylmethyl)-2,5-dimethylbenzene (PubChem CID 59821631) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is 1,4-bis(cyclohexylmethyl)-2,5-dimethylbenzene.
| Compound Name | 1,4-bis(cyclohexylmethyl)-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 59821631 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 1,4-bis(cyclohexylmethyl)-2,5-dimethylbenzene |
| SMILES | Cc1cc(CC2CCCCC2)c(C)cc1CC1CCCCC1 |
| InChI | InChI=1S/C22H34/c1-17-13-22(16-20-11-7-4-8-12-20)18(2)14-21(17)15-19-9-5-3-6-10-19/h13-14,19-20H,3-12,15-16H2,1-2H3 |
| InChIKey | ITPKJNGUFCAKCC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |