C12H20O — CID 143599991
ethane;(2,4,6-trimethylphenyl)methanol (PubChem CID 143599991) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;(2,4,6-trimethylphenyl)methanol.
| Compound Name | ethane;(2,4,6-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 143599991 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | ethane;(2,4,6-trimethylphenyl)methanol |
| SMILES | CC.Cc1cc(C)c(CO)c(C)c1 |
| InChI | InChI=1S/C10H14O.C2H6/c1-7-4-8(2)10(6-11)9(3)5-7;1-2/h4-5,11H,6H2,1-3H3;1-2H3 |
| InChIKey | GGJZXYPFIFEFLU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |