C10H14O2P+ — CID 175828845
hydroxy-oxo-[(2,4,6-trimethylphenyl)methyl]phosphanium (PubChem CID 175828845) has the molecular formula C10H14O2P+ and a molecular weight of 197.19 g/mol. Its IUPAC name is hydroxy-oxo-[(2,4,6-trimethylphenyl)methyl]phosphanium.
| Compound Name | hydroxy-oxo-[(2,4,6-trimethylphenyl)methyl]phosphanium |
|---|---|
| PubChem CID | 175828845 |
| Molecular Formula | C10H14O2P+ |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | hydroxy-oxo-[(2,4,6-trimethylphenyl)methyl]phosphanium |
| SMILES | Cc1cc(C)c(C[P+](=O)O)c(C)c1 |
| InChI | InChI=1S/C10H13O2P/c1-7-4-8(2)10(6-13(11)12)9(3)5-7/h4-5H,6H2,1-3H3/p+1 |
| InChIKey | GBXWMKIVVXUQBA-UHFFFAOYSA-O |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|