C10H13NO2 — CID 145272360
[2,6-dimethyl-4-(nitrosomethyl)phenyl]methanol (PubChem CID 145272360) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is [2,6-dimethyl-4-(nitrosomethyl)phenyl]methanol.
| Compound Name | [2,6-dimethyl-4-(nitrosomethyl)phenyl]methanol |
|---|---|
| PubChem CID | 145272360 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | [2,6-dimethyl-4-(nitrosomethyl)phenyl]methanol |
| SMILES | Cc1cc(CN=O)cc(C)c1CO |
| InChI | InChI=1S/C10H13NO2/c1-7-3-9(5-11-13)4-8(2)10(7)6-12/h3-4,12H,5-6H2,1-2H3 |
| InChIKey | WPTMPKLJZYEHKJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |