C12H16O3 — CID 57437403
3-[4-(hydroxymethyl)-2,6-dimethylphenyl]propanoic acid (PubChem CID 57437403) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-[4-(hydroxymethyl)-2,6-dimethylphenyl]propanoic acid.
| Compound Name | 3-[4-(hydroxymethyl)-2,6-dimethylphenyl]propanoic acid |
|---|---|
| PubChem CID | 57437403 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-[4-(hydroxymethyl)-2,6-dimethylphenyl]propanoic acid |
| SMILES | Cc1cc(CO)cc(C)c1CCC(=O)O |
| InChI | InChI=1S/C12H16O3/c1-8-5-10(7-13)6-9(2)11(8)3-4-12(14)15/h5-6,13H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | AIJAUQSBCHRMEO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |