C13H18O2Y — CID 59858101
3-(4-ethyl-3,5-dimethylphenyl)propanoic acid;yttrium (PubChem CID 59858101) has the molecular formula C13H18O2Y and a molecular weight of 295.19 g/mol. Its IUPAC name is 3-(4-ethyl-3,5-dimethylphenyl)propanoic acid;yttrium.
| Compound Name | 3-(4-ethyl-3,5-dimethylphenyl)propanoic acid;yttrium |
|---|---|
| PubChem CID | 59858101 |
| Molecular Formula | C13H18O2Y |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-(4-ethyl-3,5-dimethylphenyl)propanoic acid;yttrium |
| SMILES | CCc1c(C)cc(CCC(=O)O)cc1C.[Y] |
| InChI | InChI=1S/C13H18O2.Y/c1-4-12-9(2)7-11(8-10(12)3)5-6-13(14)15;/h7-8H,4-6H2,1-3H3,(H,14,15); |
| InChIKey | FSSCEHXGGHUERT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |