C15H26O3 — CID 144504832
ethane;3-(4-hydroxy-3,5-dimethylphenyl)propanoic acid (PubChem CID 144504832) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is ethane;3-(4-hydroxy-3,5-dimethylphenyl)propanoic acid.
| Compound Name | ethane;3-(4-hydroxy-3,5-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 144504832 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | ethane;3-(4-hydroxy-3,5-dimethylphenyl)propanoic acid |
| SMILES | CC.CC.Cc1cc(CCC(=O)O)cc(C)c1O |
| InChI | InChI=1S/C11H14O3.2C2H6/c1-7-5-9(3-4-10(12)13)6-8(2)11(7)14;2*1-2/h5-6,14H,3-4H2,1-2H3,(H,12,13);2*1-2H3 |
| InChIKey | KTLATFRSCGNNIH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |